| dc.contributor.author |
Vaidhyanathan, R
|
|
| dc.contributor.author |
Natarajan, Srinivasan
|
|
| dc.contributor.author |
Rao, C N R
|
|
| dc.date.accessioned |
2012-02-16T06:16:53Z |
|
| dc.date.available |
2012-02-16T06:16:53Z |
|
| dc.date.issued |
2003-05 |
|
| dc.identifier |
1434-1948 |
en_US |
| dc.identifier.citation |
European Journal Of Inorganic Chemistry (9), 1675-1680 (2003) |
en_US |
| dc.identifier.uri |
https://libjncir.jncasr.ac.in/xmlui/10572/443 |
|
| dc.description |
Restricted Access |
en_US |
| dc.description.abstract |
The metathesis reaction between CdCl2.2H(2)O and sodium oxalate in n-hexanol under solvothermal conditions yields a hybrid compound of formula Cd-2(C2O4)(0.5)Cl3NaCl.4H(2)O, It consists of one-dimensional chains formed by Cd and Cl atoms, containing mu(2)(Cl) and mu(3)(Cl) bridges, and cross-linked by oxalate units to give a layered structure. The Na+ ions and water molecules occupy the interlamellar spaces. ((C) Wiley-VCH Verlag GmbH & Co. KGaA, 69451 Weinheim, Germany, 2003). |
en_US |
| dc.description.uri |
http://dx.doi.org/ 10.1002/ejic.200200612 |
en_US |
| dc.language.iso |
en |
en_US |
| dc.publisher |
WILEY-VCH Verlag GmbH |
en_US |
| dc.rights |
© 2003 WILEY-VCH Verlag GmbH & Co |
en_US |
| dc.subject |
materials science |
en_US |
| dc.subject |
cadmium |
en_US |
| dc.subject |
solvothermal synthesis |
en_US |
| dc.subject |
metathesis |
en_US |
| dc.subject |
Hydrothermal Synthesis |
en_US |
| dc.subject |
X-Ray |
en_US |
| dc.subject |
Crystal-Structure |
en_US |
| dc.subject |
Cadmium Oxalates |
en_US |
| dc.subject |
Chemistry |
en_US |
| dc.subject |
Units |
en_US |
| dc.subject |
Phosphates |
en_US |
| dc.subject |
Clusters |
en_US |
| dc.subject |
Channels |
en_US |
| dc.subject |
Behavior |
en_US |
| dc.title |
Solvothermal Synthesis of a Layered Open-Framework Chlorocadmium Oxalate, Cd2(C2O4)0.5Cl3NaCl·4H2O |
en_US |
| dc.type |
Article |
en_US |